C12H16F3NO — CID 171205463
(1R)-4,4,4-trifluoro-1-(3-methoxy-4-methylphenyl)butan-1-amine (PubChem CID 171205463) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is (1R)-4,4,4-trifluoro-1-(3-methoxy-4-methylphenyl)butan-1-amine.
| Compound Name | (1R)-4,4,4-trifluoro-1-(3-methoxy-4-methylphenyl)butan-1-amine |
|---|---|
| PubChem CID | 171205463 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (1R)-4,4,4-trifluoro-1-(3-methoxy-4-methylphenyl)butan-1-amine |
| SMILES | COc1cc([C@H](N)CCC(F)(F)F)ccc1C |
| InChI | InChI=1S/C12H16F3NO/c1-8-3-4-9(7-11(8)17-2)10(16)5-6-12(13,14)15/h3-4,7,10H,5-6,16H2,1-2H3/t10-/m1/s1 |
| InChIKey | UDVTZDKDMJMTPY-SNVBAGLBSA-N |
| XLogP | 3.35 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |