C11H15F2NO — CID 131561206
(3R)-3-amino-3-(3,4-dimethylphenyl)-2,2-difluoropropan-1-ol (PubChem CID 131561206) has the molecular formula C11H15F2NO and a molecular weight of 215.24 g/mol. Its IUPAC name is (3R)-3-amino-3-(3,4-dimethylphenyl)-2,2-difluoropropan-1-ol.
| Compound Name | (3R)-3-amino-3-(3,4-dimethylphenyl)-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 131561206 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | (3R)-3-amino-3-(3,4-dimethylphenyl)-2,2-difluoropropan-1-ol |
| SMILES | Cc1ccc([C@@H](N)C(F)(F)CO)cc1C |
| InChI | InChI=1S/C11H15F2NO/c1-7-3-4-9(5-8(7)2)10(14)11(12,13)6-15/h3-5,10,15H,6,14H2,1-2H3/t10-/m1/s1 |
| InChIKey | TZTRMYNCMIUODG-SNVBAGLBSA-N |
| XLogP | 1.93 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |