C9H10F3NO — CID 130642630
(3R)-3-amino-2,2-difluoro-3-(3-fluorophenyl)propan-1-ol (PubChem CID 130642630) has the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. Its IUPAC name is (3R)-3-amino-2,2-difluoro-3-(3-fluorophenyl)propan-1-ol.
| Compound Name | (3R)-3-amino-2,2-difluoro-3-(3-fluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 130642630 |
| Molecular Formula | C9H10F3NO |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (3R)-3-amino-2,2-difluoro-3-(3-fluorophenyl)propan-1-ol |
| SMILES | N[C@H](c1cccc(F)c1)C(F)(F)CO |
| InChI | InChI=1S/C9H10F3NO/c10-7-3-1-2-6(4-7)8(13)9(11,12)5-14/h1-4,8,14H,5,13H2/t8-/m1/s1 |
| InChIKey | VBHKFNNLTLLOBI-MRVPVSSYSA-N |
| XLogP | 1.45 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |