C11H15F2NO2 — CID 171241497
(3R)-3-amino-3-(3-ethoxyphenyl)-2,2-difluoropropan-1-ol (PubChem CID 171241497) has the molecular formula C11H15F2NO2 and a molecular weight of 231.24 g/mol. Its IUPAC name is (3R)-3-amino-3-(3-ethoxyphenyl)-2,2-difluoropropan-1-ol.
| Compound Name | (3R)-3-amino-3-(3-ethoxyphenyl)-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 171241497 |
| Molecular Formula | C11H15F2NO2 |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (3R)-3-amino-3-(3-ethoxyphenyl)-2,2-difluoropropan-1-ol |
| SMILES | CCOc1cccc([C@@H](N)C(F)(F)CO)c1 |
| InChI | InChI=1S/C11H15F2NO2/c1-2-16-9-5-3-4-8(6-9)10(14)11(12,13)7-15/h3-6,10,15H,2,7,14H2,1H3/t10-/m1/s1 |
| InChIKey | UGCNKECGSSQCAR-SNVBAGLBSA-N |
| XLogP | 1.71 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |