C10H13F2NO2 — CID 171239633
(3R)-3-amino-2,2-difluoro-3-(3-methoxyphenyl)propan-1-ol (PubChem CID 171239633) has the molecular formula C10H13F2NO2 and a molecular weight of 217.22 g/mol. Its IUPAC name is (3R)-3-amino-2,2-difluoro-3-(3-methoxyphenyl)propan-1-ol.
| Compound Name | (3R)-3-amino-2,2-difluoro-3-(3-methoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 171239633 |
| Molecular Formula | C10H13F2NO2 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | (3R)-3-amino-2,2-difluoro-3-(3-methoxyphenyl)propan-1-ol |
| SMILES | COc1cccc([C@@H](N)C(F)(F)CO)c1 |
| InChI | InChI=1S/C10H13F2NO2/c1-15-8-4-2-3-7(5-8)9(13)10(11,12)6-14/h2-5,9,14H,6,13H2,1H3/t9-/m1/s1 |
| InChIKey | LPBISXSOQMDOTO-SECBINFHSA-N |
| XLogP | 1.32 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |