C15H15F2NO — CID 171244503
(3R)-3-amino-2,2-difluoro-3-(3-phenylphenyl)propan-1-ol (PubChem CID 171244503) has the molecular formula C15H15F2NO and a molecular weight of 263.29 g/mol. Its IUPAC name is (3R)-3-amino-2,2-difluoro-3-(3-phenylphenyl)propan-1-ol.
| Compound Name | (3R)-3-amino-2,2-difluoro-3-(3-phenylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 171244503 |
| Molecular Formula | C15H15F2NO |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | (3R)-3-amino-2,2-difluoro-3-(3-phenylphenyl)propan-1-ol |
| SMILES | N[C@H](c1cccc(-c2ccccc2)c1)C(F)(F)CO |
| InChI | InChI=1S/C15H15F2NO/c16-15(17,10-19)14(18)13-8-4-7-12(9-13)11-5-2-1-3-6-11/h1-9,14,19H,10,18H2/t14-/m1/s1 |
| InChIKey | RAEFEEFRVWJNLU-CQSZACIVSA-N |
| XLogP | 2.98 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |