C16H18F2N2O — CID 171240157
(3R)-3-amino-3-[4-(benzylamino)phenyl]-2,2-difluoropropan-1-ol (PubChem CID 171240157) has the molecular formula C16H18F2N2O and a molecular weight of 292.33 g/mol. Its IUPAC name is (3R)-3-amino-3-[4-(benzylamino)phenyl]-2,2-difluoropropan-1-ol.
| Compound Name | (3R)-3-amino-3-[4-(benzylamino)phenyl]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 171240157 |
| Molecular Formula | C16H18F2N2O |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | (3R)-3-amino-3-[4-(benzylamino)phenyl]-2,2-difluoropropan-1-ol |
| SMILES | N[C@H](c1ccc(NCc2ccccc2)cc1)C(F)(F)CO |
| InChI | InChI=1S/C16H18F2N2O/c17-16(18,11-21)15(19)13-6-8-14(9-7-13)20-10-12-4-2-1-3-5-12/h1-9,15,20-21H,10-11,19H2/t15-/m1/s1 |
| InChIKey | YDHFKERCLDMPAX-OAHLLOKOSA-N |
| XLogP | 2.93 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |