C16H21ClN2O — CID 171261462
(1R,2S)-1-amino-1-[4-(benzylamino)phenyl]propan-2-ol;hydrochloride (PubChem CID 171261462) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-[4-(benzylamino)phenyl]propan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-[4-(benzylamino)phenyl]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171261462 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (1R,2S)-1-amino-1-[4-(benzylamino)phenyl]propan-2-ol;hydrochloride |
| SMILES | C[C@H](O)[C@H](N)c1ccc(NCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C16H20N2O.ClH/c1-12(19)16(17)14-7-9-15(10-8-14)18-11-13-5-3-2-4-6-13;/h2-10,12,16,18-19H,11,17H2,1H3;1H/t12-,16-;/m0./s1 |
| InChIKey | SVIIWZAJLHUAGQ-MIRNQTQTSA-N |
| XLogP | 3.10 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |