C17H23ClN2 — CID 171201534
4-[(1R)-1-aminobutyl]-N-benzylaniline;hydrochloride (PubChem CID 171201534) has the molecular formula C17H23ClN2 and a molecular weight of 290.84 g/mol. Its IUPAC name is 4-[(1R)-1-aminobutyl]-N-benzylaniline;hydrochloride.
| Compound Name | 4-[(1R)-1-aminobutyl]-N-benzylaniline;hydrochloride |
|---|---|
| PubChem CID | 171201534 |
| Molecular Formula | C17H23ClN2 |
| Molecular Weight | 290.84 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 4-[(1R)-1-aminobutyl]-N-benzylaniline;hydrochloride |
| SMILES | CCC[C@@H](N)c1ccc(NCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C17H22N2.ClH/c1-2-6-17(18)15-9-11-16(12-10-15)19-13-14-7-4-3-5-8-14;/h3-5,7-12,17,19H,2,6,13,18H2,1H3;1H/t17-;/m1./s1 |
| InChIKey | QQZJXKZLALNQRG-UNTBIKODSA-N |
| XLogP | 4.52 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.84 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |