C18H23ClN2 — CID 171221102
4-[(1S)-1-aminopent-4-enyl]-N-benzylaniline;hydrochloride (PubChem CID 171221102) has the molecular formula C18H23ClN2 and a molecular weight of 302.85 g/mol. Its IUPAC name is 4-[(1S)-1-aminopent-4-enyl]-N-benzylaniline;hydrochloride.
| Compound Name | 4-[(1S)-1-aminopent-4-enyl]-N-benzylaniline;hydrochloride |
|---|---|
| PubChem CID | 171221102 |
| Molecular Formula | C18H23ClN2 |
| Molecular Weight | 302.85 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 4-[(1S)-1-aminopent-4-enyl]-N-benzylaniline;hydrochloride |
| SMILES | C=CCC[C@H](N)c1ccc(NCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C18H22N2.ClH/c1-2-3-9-18(19)16-10-12-17(13-11-16)20-14-15-7-5-4-6-8-15;/h2,4-8,10-13,18,20H,1,3,9,14,19H2;1H/t18-;/m0./s1 |
| InChIKey | ABEUGXXYZKZNDA-FERBBOLQSA-N |
| XLogP | 4.69 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.85 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|