C21H29N3 — CID 171275088
N-benzyl-4-[(1S)-1-piperazin-1-ylbutyl]aniline (PubChem CID 171275088) has the molecular formula C21H29N3 and a molecular weight of 323.48 g/mol. Its IUPAC name is N-benzyl-4-[(1S)-1-piperazin-1-ylbutyl]aniline.
| Compound Name | N-benzyl-4-[(1S)-1-piperazin-1-ylbutyl]aniline |
|---|---|
| PubChem CID | 171275088 |
| Molecular Formula | C21H29N3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | N-benzyl-4-[(1S)-1-piperazin-1-ylbutyl]aniline |
| SMILES | CCC[C@@H](c1ccc(NCc2ccccc2)cc1)N1CCNCC1 |
| InChI | InChI=1S/C21H29N3/c1-2-6-21(24-15-13-22-14-16-24)19-9-11-20(12-10-19)23-17-18-7-4-3-5-8-18/h3-5,7-12,21-23H,2,6,13-17H2,1H3/t21-/m0/s1 |
| InChIKey | DEBLJVGDGLGKCK-NRFANRHFSA-N |
| XLogP | 4.05 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |