C20H26Cl2N4 — CID 171305909
(3S)-3-[4-(benzylamino)phenyl]-3-piperazin-1-ylpropanenitrile;dihydrochloride (PubChem CID 171305909) has the molecular formula C20H26Cl2N4 and a molecular weight of 393.36 g/mol. Its IUPAC name is (3S)-3-[4-(benzylamino)phenyl]-3-piperazin-1-ylpropanenitrile;dihydrochloride.
| Compound Name | (3S)-3-[4-(benzylamino)phenyl]-3-piperazin-1-ylpropanenitrile;dihydrochloride |
|---|---|
| PubChem CID | 171305909 |
| Molecular Formula | C20H26Cl2N4 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (3S)-3-[4-(benzylamino)phenyl]-3-piperazin-1-ylpropanenitrile;dihydrochloride |
| SMILES | Cl.Cl.N#CC[C@@H](c1ccc(NCc2ccccc2)cc1)N1CCNCC1 |
| InChI | InChI=1S/C20H24N4.2ClH/c21-11-10-20(24-14-12-22-13-15-24)18-6-8-19(9-7-18)23-16-17-4-2-1-3-5-17;;/h1-9,20,22-23H,10,12-16H2;2*1H/t20-;;/m0../s1 |
| InChIKey | ZBAXZURQWDWZKP-FJSYBICCSA-N |
| XLogP | 4.00 |
| TPSA | 51.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |