C22H33Cl2N3 — CID 171308846
N-benzyl-4-[(1S)-1-piperazin-1-ylpentyl]aniline;dihydrochloride (PubChem CID 171308846) has the molecular formula C22H33Cl2N3 and a molecular weight of 410.43 g/mol. Its IUPAC name is N-benzyl-4-[(1S)-1-piperazin-1-ylpentyl]aniline;dihydrochloride.
| Compound Name | N-benzyl-4-[(1S)-1-piperazin-1-ylpentyl]aniline;dihydrochloride |
|---|---|
| PubChem CID | 171308846 |
| Molecular Formula | C22H33Cl2N3 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | N-benzyl-4-[(1S)-1-piperazin-1-ylpentyl]aniline;dihydrochloride |
| SMILES | CCCC[C@@H](c1ccc(NCc2ccccc2)cc1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C22H31N3.2ClH/c1-2-3-9-22(25-16-14-23-15-17-25)20-10-12-21(13-11-20)24-18-19-7-5-4-6-8-19;;/h4-8,10-13,22-24H,2-3,9,14-18H2,1H3;2*1H/t22-;;/m0../s1 |
| InChIKey | IPQPMFIMJAQVTO-IKXQUJFKSA-N |
| XLogP | 5.28 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |