C20H28Cl2N2 — CID 171292164
1-[(1R)-1-(4-phenylphenyl)butyl]piperazine;dihydrochloride (PubChem CID 171292164) has the molecular formula C20H28Cl2N2 and a molecular weight of 367.36 g/mol. Its IUPAC name is 1-[(1R)-1-(4-phenylphenyl)butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(4-phenylphenyl)butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171292164 |
| Molecular Formula | C20H28Cl2N2 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 1-[(1R)-1-(4-phenylphenyl)butyl]piperazine;dihydrochloride |
| SMILES | CCC[C@H](c1ccc(-c2ccccc2)cc1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C20H26N2.2ClH/c1-2-6-20(22-15-13-21-14-16-22)19-11-9-18(10-12-19)17-7-4-3-5-8-17;;/h3-5,7-12,20-21H,2,6,13-16H2,1H3;2*1H/t20-;;/m1../s1 |
| InChIKey | IWLGJWWBKJLAND-FAVHNTAZSA-N |
| XLogP | 4.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |