C22H30N2 — CID 171310273
1-[(1S)-4-methyl-1-(4-phenylphenyl)pentyl]piperazine (PubChem CID 171310273) has the molecular formula C22H30N2 and a molecular weight of 322.50 g/mol. Its IUPAC name is 1-[(1S)-4-methyl-1-(4-phenylphenyl)pentyl]piperazine.
| Compound Name | 1-[(1S)-4-methyl-1-(4-phenylphenyl)pentyl]piperazine |
|---|---|
| PubChem CID | 171310273 |
| Molecular Formula | C22H30N2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 1-[(1S)-4-methyl-1-(4-phenylphenyl)pentyl]piperazine |
| SMILES | CC(C)CC[C@@H](c1ccc(-c2ccccc2)cc1)N1CCNCC1 |
| InChI | InChI=1S/C22H30N2/c1-18(2)8-13-22(24-16-14-23-15-17-24)21-11-9-20(10-12-21)19-6-4-3-5-7-19/h3-7,9-12,18,22-23H,8,13-17H2,1-2H3/t22-/m0/s1 |
| InChIKey | GWYNINFBFJVNMZ-QFIPXVFZSA-N |
| XLogP | 4.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |