C19H34N2OSi — CID 171311005
trimethyl-[4-[(1R)-4-methyl-1-piperazin-1-ylpentyl]phenoxy]silane (PubChem CID 171311005) has the molecular formula C19H34N2OSi and a molecular weight of 334.58 g/mol. Its IUPAC name is trimethyl-[4-[(1R)-4-methyl-1-piperazin-1-ylpentyl]phenoxy]silane.
| Compound Name | trimethyl-[4-[(1R)-4-methyl-1-piperazin-1-ylpentyl]phenoxy]silane |
|---|---|
| PubChem CID | 171311005 |
| Molecular Formula | C19H34N2OSi |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | trimethyl-[4-[(1R)-4-methyl-1-piperazin-1-ylpentyl]phenoxy]silane |
| SMILES | CC(C)CC[C@H](c1ccc(O[Si](C)(C)C)cc1)N1CCNCC1 |
| InChI | InChI=1S/C19H34N2OSi/c1-16(2)6-11-19(21-14-12-20-13-15-21)17-7-9-18(10-8-17)22-23(3,4)5/h7-10,16,19-20H,6,11-15H2,1-5H3/t19-/m1/s1 |
| InChIKey | WUQATJWDGREZBM-LJQANCHMSA-N |
| XLogP | 4.28 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|