C15H27Cl2FN2OSi — CID 171291647
[4-[(1S)-2-fluoro-1-piperazin-1-ylethyl]phenoxy]-trimethylsilane;dihydrochloride (PubChem CID 171291647) has the molecular formula C15H27Cl2FN2OSi and a molecular weight of 369.38 g/mol. Its IUPAC name is [4-[(1S)-2-fluoro-1-piperazin-1-ylethyl]phenoxy]-trimethylsilane;dihydrochloride.
| Compound Name | [4-[(1S)-2-fluoro-1-piperazin-1-ylethyl]phenoxy]-trimethylsilane;dihydrochloride |
|---|---|
| PubChem CID | 171291647 |
| Molecular Formula | C15H27Cl2FN2OSi |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | [4-[(1S)-2-fluoro-1-piperazin-1-ylethyl]phenoxy]-trimethylsilane;dihydrochloride |
| SMILES | C[Si](C)(C)Oc1ccc([C@@H](CF)N2CCNCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C15H25FN2OSi.2ClH/c1-20(2,3)19-14-6-4-13(5-7-14)15(12-16)18-10-8-17-9-11-18;;/h4-7,15,17H,8-12H2,1-3H3;2*1H/t15-;;/m1../s1 |
| InChIKey | DWLANXXTNHHGFJ-QCUBGVIVSA-N |
| XLogP | 3.66 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|