C15H24ClF3N2OSi — CID 171176581
trimethyl-[4-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenoxy]silane;hydrochloride (PubChem CID 171176581) has the molecular formula C15H24ClF3N2OSi and a molecular weight of 368.90 g/mol. Its IUPAC name is trimethyl-[4-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenoxy]silane;hydrochloride.
| Compound Name | trimethyl-[4-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenoxy]silane;hydrochloride |
|---|---|
| PubChem CID | 171176581 |
| Molecular Formula | C15H24ClF3N2OSi |
| Molecular Weight | 368.90 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | trimethyl-[4-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenoxy]silane;hydrochloride |
| SMILES | C[Si](C)(C)Oc1ccc([C@H](N2CCNCC2)C(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C15H23F3N2OSi.ClH/c1-22(2,3)21-13-6-4-12(5-7-13)14(15(16,17)18)20-10-8-19-9-11-20;/h4-7,14,19H,8-11H2,1-3H3;1H/t14-;/m0./s1 |
| InChIKey | UGGFICKJPRVSFY-UQKRIMTDSA-N |
| XLogP | 3.83 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.90 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|