C16H28Cl2N2OSi — CID 171291643
trimethyl-[4-[(1R)-1-piperazin-1-ylprop-2-enyl]phenoxy]silane;dihydrochloride (PubChem CID 171291643) has the molecular formula C16H28Cl2N2OSi and a molecular weight of 363.41 g/mol. Its IUPAC name is trimethyl-[4-[(1R)-1-piperazin-1-ylprop-2-enyl]phenoxy]silane;dihydrochloride.
| Compound Name | trimethyl-[4-[(1R)-1-piperazin-1-ylprop-2-enyl]phenoxy]silane;dihydrochloride |
|---|---|
| PubChem CID | 171291643 |
| Molecular Formula | C16H28Cl2N2OSi |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | trimethyl-[4-[(1R)-1-piperazin-1-ylprop-2-enyl]phenoxy]silane;dihydrochloride |
| SMILES | C=C[C@H](c1ccc(O[Si](C)(C)C)cc1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H26N2OSi.2ClH/c1-5-16(18-12-10-17-11-13-18)14-6-8-15(9-7-14)19-20(2,3)4;;/h5-9,16-17H,1,10-13H2,2-4H3;2*1H/t16-;;/m1../s1 |
| InChIKey | NIRXYWKWVBPPCX-GGMCWBHBSA-N |
| XLogP | 3.88 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|