C18H32Cl2N2OSi — CID 171279042
[4-[(1S)-2-cyclopropyl-1-piperazin-1-ylethyl]phenoxy]-trimethylsilane;dihydrochloride (PubChem CID 171279042) has the molecular formula C18H32Cl2N2OSi and a molecular weight of 391.46 g/mol. Its IUPAC name is [4-[(1S)-2-cyclopropyl-1-piperazin-1-ylethyl]phenoxy]-trimethylsilane;dihydrochloride.
| Compound Name | [4-[(1S)-2-cyclopropyl-1-piperazin-1-ylethyl]phenoxy]-trimethylsilane;dihydrochloride |
|---|---|
| PubChem CID | 171279042 |
| Molecular Formula | C18H32Cl2N2OSi |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | [4-[(1S)-2-cyclopropyl-1-piperazin-1-ylethyl]phenoxy]-trimethylsilane;dihydrochloride |
| SMILES | C[Si](C)(C)Oc1ccc([C@H](CC2CC2)N2CCNCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C18H30N2OSi.2ClH/c1-22(2,3)21-17-8-6-16(7-9-17)18(14-15-4-5-15)20-12-10-19-11-13-20;;/h6-9,15,18-19H,4-5,10-14H2,1-3H3;2*1H/t18-;;/m0../s1 |
| InChIKey | IJJMCYUREYEGSB-NTEVMMBTSA-N |
| XLogP | 4.49 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|