C17H30N2OSi — CID 171279039
trimethyl-[4-[(1S)-1-piperazin-1-ylbutyl]phenoxy]silane (PubChem CID 171279039) has the molecular formula C17H30N2OSi and a molecular weight of 306.53 g/mol. Its IUPAC name is trimethyl-[4-[(1S)-1-piperazin-1-ylbutyl]phenoxy]silane.
| Compound Name | trimethyl-[4-[(1S)-1-piperazin-1-ylbutyl]phenoxy]silane |
|---|---|
| PubChem CID | 171279039 |
| Molecular Formula | C17H30N2OSi |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | trimethyl-[4-[(1S)-1-piperazin-1-ylbutyl]phenoxy]silane |
| SMILES | CCC[C@@H](c1ccc(O[Si](C)(C)C)cc1)N1CCNCC1 |
| InChI | InChI=1S/C17H30N2OSi/c1-5-6-17(19-13-11-18-12-14-19)15-7-9-16(10-8-15)20-21(2,3)4/h7-10,17-18H,5-6,11-14H2,1-4H3/t17-/m0/s1 |
| InChIKey | OFCKJFHPKHVLHW-KRWDZBQOSA-N |
| XLogP | 3.65 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|