C18H30N2OSi — CID 171291672
trimethyl-[4-[(1R)-1-piperazin-1-ylpent-4-enyl]phenoxy]silane (PubChem CID 171291672) has the molecular formula C18H30N2OSi and a molecular weight of 318.54 g/mol. Its IUPAC name is trimethyl-[4-[(1R)-1-piperazin-1-ylpent-4-enyl]phenoxy]silane.
| Compound Name | trimethyl-[4-[(1R)-1-piperazin-1-ylpent-4-enyl]phenoxy]silane |
|---|---|
| PubChem CID | 171291672 |
| Molecular Formula | C18H30N2OSi |
| Molecular Weight | 318.54 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | trimethyl-[4-[(1R)-1-piperazin-1-ylpent-4-enyl]phenoxy]silane |
| SMILES | C=CCC[C@H](c1ccc(O[Si](C)(C)C)cc1)N1CCNCC1 |
| InChI | InChI=1S/C18H30N2OSi/c1-5-6-7-18(20-14-12-19-13-15-20)16-8-10-17(11-9-16)21-22(2,3)4/h5,8-11,18-19H,1,6-7,12-15H2,2-4H3/t18-/m1/s1 |
| InChIKey | LEOPWMQLZDGDFN-GOSISDBHSA-N |
| XLogP | 3.81 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|