C15H21BrN2 — CID 171273720
1-[(1S)-1-(4-bromophenyl)pent-4-enyl]piperazine (PubChem CID 171273720) has the molecular formula C15H21BrN2 and a molecular weight of 309.25 g/mol. Its IUPAC name is 1-[(1S)-1-(4-bromophenyl)pent-4-enyl]piperazine.
| Compound Name | 1-[(1S)-1-(4-bromophenyl)pent-4-enyl]piperazine |
|---|---|
| PubChem CID | 171273720 |
| Molecular Formula | C15H21BrN2 |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 1-[(1S)-1-(4-bromophenyl)pent-4-enyl]piperazine |
| SMILES | C=CCC[C@@H](c1ccc(Br)cc1)N1CCNCC1 |
| InChI | InChI=1S/C15H21BrN2/c1-2-3-4-15(18-11-9-17-10-12-18)13-5-7-14(16)8-6-13/h2,5-8,15,17H,1,3-4,9-12H2/t15-/m0/s1 |
| InChIKey | UKXYEDNWFVWUSR-HNNXBMFYSA-N |
| XLogP | 3.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|