C13H21BrCl2N2S — CID 171281061
1-[(1S)-1-(3-bromothiophen-2-yl)pent-4-enyl]piperazine;dihydrochloride (PubChem CID 171281061) has the molecular formula C13H21BrCl2N2S and a molecular weight of 388.20 g/mol. Its IUPAC name is 1-[(1S)-1-(3-bromothiophen-2-yl)pent-4-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(3-bromothiophen-2-yl)pent-4-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171281061 |
| Molecular Formula | C13H21BrCl2N2S |
| Molecular Weight | 388.20 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | 1-[(1S)-1-(3-bromothiophen-2-yl)pent-4-enyl]piperazine;dihydrochloride |
| SMILES | C=CCC[C@@H](c1sccc1Br)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C13H19BrN2S.2ClH/c1-2-3-4-12(13-11(14)5-10-17-13)16-8-6-15-7-9-16;;/h2,5,10,12,15H,1,3-4,6-9H2;2*1H/t12-;;/m0../s1 |
| InChIKey | MEPLHMJYVPJVSB-LTCKWSDVSA-N |
| XLogP | 4.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.20 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|