C12H19Cl3N2S — CID 171288856
1-[(1R)-1-(3-chlorothiophen-2-yl)but-3-enyl]piperazine;dihydrochloride (PubChem CID 171288856) has the molecular formula C12H19Cl3N2S and a molecular weight of 329.72 g/mol. Its IUPAC name is 1-[(1R)-1-(3-chlorothiophen-2-yl)but-3-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(3-chlorothiophen-2-yl)but-3-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171288856 |
| Molecular Formula | C12H19Cl3N2S |
| Molecular Weight | 329.72 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 1-[(1R)-1-(3-chlorothiophen-2-yl)but-3-enyl]piperazine;dihydrochloride |
| SMILES | C=CC[C@H](c1sccc1Cl)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C12H17ClN2S.2ClH/c1-2-3-11(12-10(13)4-9-16-12)15-7-5-14-6-8-15;;/h2,4,9,11,14H,1,3,5-8H2;2*1H/t11-;;/m1../s1 |
| InChIKey | XHHCJDYKIDBVKS-NVJADKKVSA-N |
| XLogP | 3.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.72 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|