C14H22Cl3N3 — CID 171282867
4-chloro-2-[(1S)-1-piperazin-1-ylbut-3-enyl]aniline;dihydrochloride (PubChem CID 171282867) has the molecular formula C14H22Cl3N3 and a molecular weight of 338.71 g/mol. Its IUPAC name is 4-chloro-2-[(1S)-1-piperazin-1-ylbut-3-enyl]aniline;dihydrochloride.
| Compound Name | 4-chloro-2-[(1S)-1-piperazin-1-ylbut-3-enyl]aniline;dihydrochloride |
|---|---|
| PubChem CID | 171282867 |
| Molecular Formula | C14H22Cl3N3 |
| Molecular Weight | 338.71 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 4-chloro-2-[(1S)-1-piperazin-1-ylbut-3-enyl]aniline;dihydrochloride |
| SMILES | C=CC[C@@H](c1cc(Cl)ccc1N)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H20ClN3.2ClH/c1-2-3-14(18-8-6-17-7-9-18)12-10-11(15)4-5-13(12)16;;/h2,4-5,10,14,17H,1,3,6-9,16H2;2*1H/t14-;;/m0../s1 |
| InChIKey | KYCSNASKVJYPSO-UTLKBRERSA-N |
| XLogP | 3.29 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.71 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|