C14H18ClN3O2 — CID 171291021
1-[(1R)-1-(5-chloro-2-nitrophenyl)but-3-enyl]piperazine (PubChem CID 171291021) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is 1-[(1R)-1-(5-chloro-2-nitrophenyl)but-3-enyl]piperazine.
| Compound Name | 1-[(1R)-1-(5-chloro-2-nitrophenyl)but-3-enyl]piperazine |
|---|---|
| PubChem CID | 171291021 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 1-[(1R)-1-(5-chloro-2-nitrophenyl)but-3-enyl]piperazine |
| SMILES | C=CC[C@H](c1cc(Cl)ccc1[N+](=O)[O-])N1CCNCC1 |
| InChI | InChI=1S/C14H18ClN3O2/c1-2-3-13(17-8-6-16-7-9-17)12-10-11(15)4-5-14(12)18(19)20/h2,4-5,10,13,16H,1,3,6-9H2/t13-/m1/s1 |
| InChIKey | STEQIYPLDRLZCP-CYBMUJFWSA-N |
| XLogP | 2.77 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|