C13H15ClF3N3O2 — CID 171303726
1-[(1R)-1-(5-chloro-2-nitrophenyl)-3,3,3-trifluoropropyl]piperazine (PubChem CID 171303726) has the molecular formula C13H15ClF3N3O2 and a molecular weight of 337.73 g/mol. Its IUPAC name is 1-[(1R)-1-(5-chloro-2-nitrophenyl)-3,3,3-trifluoropropyl]piperazine.
| Compound Name | 1-[(1R)-1-(5-chloro-2-nitrophenyl)-3,3,3-trifluoropropyl]piperazine |
|---|---|
| PubChem CID | 171303726 |
| Molecular Formula | C13H15ClF3N3O2 |
| Molecular Weight | 337.73 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 1-[(1R)-1-(5-chloro-2-nitrophenyl)-3,3,3-trifluoropropyl]piperazine |
| SMILES | O=[N+]([O-])c1ccc(Cl)cc1[C@@H](CC(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C13H15ClF3N3O2/c14-9-1-2-11(20(21)22)10(7-9)12(8-13(15,16)17)19-5-3-18-4-6-19/h1-2,7,12,18H,3-6,8H2/t12-/m1/s1 |
| InChIKey | XIGXIIYZEGJBJN-GFCCVEGCSA-N |
| XLogP | 3.15 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.73 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|