C13H17Cl3F3N3O2 — CID 171302783
1-[(1S)-1-(2-chloro-5-nitrophenyl)-3,3,3-trifluoropropyl]piperazine;dihydrochloride (PubChem CID 171302783) has the molecular formula C13H17Cl3F3N3O2 and a molecular weight of 410.65 g/mol. Its IUPAC name is 1-[(1S)-1-(2-chloro-5-nitrophenyl)-3,3,3-trifluoropropyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(2-chloro-5-nitrophenyl)-3,3,3-trifluoropropyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171302783 |
| Molecular Formula | C13H17Cl3F3N3O2 |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 1-[(1S)-1-(2-chloro-5-nitrophenyl)-3,3,3-trifluoropropyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.O=[N+]([O-])c1ccc(Cl)c([C@H](CC(F)(F)F)N2CCNCC2)c1 |
| InChI | InChI=1S/C13H15ClF3N3O2.2ClH/c14-11-2-1-9(20(21)22)7-10(11)12(8-13(15,16)17)19-5-3-18-4-6-19;;/h1-2,7,12,18H,3-6,8H2;2*1H/t12-;;/m0../s1 |
| InChIKey | YFCBSEBLVNTFOW-LTCKWSDVSA-N |
| XLogP | 3.99 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|