C14H20Cl2F3N3O2 — CID 171302315
1-[(1S)-4,4,4-trifluoro-1-(4-nitrophenyl)butyl]piperazine;dihydrochloride (PubChem CID 171302315) has the molecular formula C14H20Cl2F3N3O2 and a molecular weight of 390.23 g/mol. Its IUPAC name is 1-[(1S)-4,4,4-trifluoro-1-(4-nitrophenyl)butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-4,4,4-trifluoro-1-(4-nitrophenyl)butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171302315 |
| Molecular Formula | C14H20Cl2F3N3O2 |
| Molecular Weight | 390.23 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 1-[(1S)-4,4,4-trifluoro-1-(4-nitrophenyl)butyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.O=[N+]([O-])c1ccc([C@H](CCC(F)(F)F)N2CCNCC2)cc1 |
| InChI | InChI=1S/C14H18F3N3O2.2ClH/c15-14(16,17)6-5-13(19-9-7-18-8-10-19)11-1-3-12(4-2-11)20(21)22;;/h1-4,13,18H,5-10H2;2*1H/t13-;;/m0../s1 |
| InChIKey | BLBDMJLCHJSXSZ-GXKRWWSZSA-N |
| XLogP | 3.73 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.23 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|