C15H21F3N2O2S — CID 171162701
1-[(1S)-4,4,4-trifluoro-1-(4-methylsulfonylphenyl)butyl]piperazine (PubChem CID 171162701) has the molecular formula C15H21F3N2O2S and a molecular weight of 350.41 g/mol. Its IUPAC name is 1-[(1S)-4,4,4-trifluoro-1-(4-methylsulfonylphenyl)butyl]piperazine.
| Compound Name | 1-[(1S)-4,4,4-trifluoro-1-(4-methylsulfonylphenyl)butyl]piperazine |
|---|---|
| PubChem CID | 171162701 |
| Molecular Formula | C15H21F3N2O2S |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-[(1S)-4,4,4-trifluoro-1-(4-methylsulfonylphenyl)butyl]piperazine |
| SMILES | CS(=O)(=O)c1ccc([C@H](CCC(F)(F)F)N2CCNCC2)cc1 |
| InChI | InChI=1S/C15H21F3N2O2S/c1-23(21,22)13-4-2-12(3-5-13)14(6-7-15(16,17)18)20-10-8-19-9-11-20/h2-5,14,19H,6-11H2,1H3/t14-/m0/s1 |
| InChIKey | OYNZAAPMZKBLSP-AWEZNQCLSA-N |
| XLogP | 2.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |