C14H19F3N2O2S — CID 171162703
1-[(1S)-3,3,3-trifluoro-1-(4-methylsulfonylphenyl)propyl]piperazine (PubChem CID 171162703) has the molecular formula C14H19F3N2O2S and a molecular weight of 336.38 g/mol. Its IUPAC name is 1-[(1S)-3,3,3-trifluoro-1-(4-methylsulfonylphenyl)propyl]piperazine.
| Compound Name | 1-[(1S)-3,3,3-trifluoro-1-(4-methylsulfonylphenyl)propyl]piperazine |
|---|---|
| PubChem CID | 171162703 |
| Molecular Formula | C14H19F3N2O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 1-[(1S)-3,3,3-trifluoro-1-(4-methylsulfonylphenyl)propyl]piperazine |
| SMILES | CS(=O)(=O)c1ccc([C@H](CC(F)(F)F)N2CCNCC2)cc1 |
| InChI | InChI=1S/C14H19F3N2O2S/c1-22(20,21)12-4-2-11(3-5-12)13(10-14(15,16)17)19-8-6-18-7-9-19/h2-5,13,18H,6-10H2,1H3/t13-/m0/s1 |
| InChIKey | CAZCWKRVTLRHRU-ZDUSSCGKSA-N |
| XLogP | 1.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |