C15H26Cl2N2O2S — CID 171272715
1-[(1S)-1-(4-methylsulfonylphenyl)butyl]piperazine;dihydrochloride (PubChem CID 171272715) has the molecular formula C15H26Cl2N2O2S and a molecular weight of 369.36 g/mol. Its IUPAC name is 1-[(1S)-1-(4-methylsulfonylphenyl)butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(4-methylsulfonylphenyl)butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171272715 |
| Molecular Formula | C15H26Cl2N2O2S |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 1-[(1S)-1-(4-methylsulfonylphenyl)butyl]piperazine;dihydrochloride |
| SMILES | CCC[C@@H](c1ccc(S(C)(=O)=O)cc1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H24N2O2S.2ClH/c1-3-4-15(17-11-9-16-10-12-17)13-5-7-14(8-6-13)20(2,18)19;;/h5-8,15-16H,3-4,9-12H2,1-2H3;2*1H/t15-;;/m0../s1 |
| InChIKey | GFYSVUUAAZCSAU-CKUXDGONSA-N |
| XLogP | 2.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |