C14H22Cl2N2O2S — CID 171285322
1-[(1R)-1-(4-methylsulfonylphenyl)prop-2-enyl]piperazine;dihydrochloride (PubChem CID 171285322) has the molecular formula C14H22Cl2N2O2S and a molecular weight of 353.32 g/mol. Its IUPAC name is 1-[(1R)-1-(4-methylsulfonylphenyl)prop-2-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(4-methylsulfonylphenyl)prop-2-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171285322 |
| Molecular Formula | C14H22Cl2N2O2S |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 1-[(1R)-1-(4-methylsulfonylphenyl)prop-2-enyl]piperazine;dihydrochloride |
| SMILES | C=C[C@H](c1ccc(S(C)(=O)=O)cc1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H20N2O2S.2ClH/c1-3-14(16-10-8-15-9-11-16)12-4-6-13(7-5-12)19(2,17)18;;/h3-7,14-15H,1,8-11H2,2H3;2*1H/t14-;;/m1../s1 |
| InChIKey | UBYWXXAMVGKTGJ-FMOMHUKBSA-N |
| XLogP | 2.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|