C16H22Cl2N2O2S2 — CID 171272709
1-[(R)-(4-methylsulfonylphenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride (PubChem CID 171272709) has the molecular formula C16H22Cl2N2O2S2 and a molecular weight of 409.40 g/mol. Its IUPAC name is 1-[(R)-(4-methylsulfonylphenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-(4-methylsulfonylphenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171272709 |
| Molecular Formula | C16H22Cl2N2O2S2 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 1-[(R)-(4-methylsulfonylphenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride |
| SMILES | CS(=O)(=O)c1ccc([C@H](c2cccs2)N2CCNCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C16H20N2O2S2.2ClH/c1-22(19,20)14-6-4-13(5-7-14)16(15-3-2-12-21-15)18-10-8-17-9-11-18;;/h2-7,12,16-17H,8-11H2,1H3;2*1H/t16-;;/m1../s1 |
| InChIKey | COGXMEIWMPEFNU-GGMCWBHBSA-N |
| XLogP | 2.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |