C17H23N3S — CID 4988870
N,N-dimethyl-4-[piperazin-1-yl(thiophen-2-yl)methyl]aniline (PubChem CID 4988870) has the molecular formula C17H23N3S and a molecular weight of 301.46 g/mol. Its IUPAC name is N,N-dimethyl-4-[piperazin-1-yl(thiophen-2-yl)methyl]aniline.
| Compound Name | N,N-dimethyl-4-[piperazin-1-yl(thiophen-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 4988870 |
| Molecular Formula | C17H23N3S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | N,N-dimethyl-4-[piperazin-1-yl(thiophen-2-yl)methyl]aniline |
| SMILES | CN(C)c1ccc(C(c2cccs2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C17H23N3S/c1-19(2)15-7-5-14(6-8-15)17(16-4-3-13-21-16)20-11-9-18-10-12-20/h3-8,13,17-18H,9-12H2,1-2H3 |
| InChIKey | FBPKBTOLWWIJQM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|