C16H19Cl2F3N2S — CID 171273194
1-[(R)-thiophen-2-yl-[4-(trifluoromethyl)phenyl]methyl]piperazine;dihydrochloride (PubChem CID 171273194) has the molecular formula C16H19Cl2F3N2S and a molecular weight of 399.31 g/mol. Its IUPAC name is 1-[(R)-thiophen-2-yl-[4-(trifluoromethyl)phenyl]methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-thiophen-2-yl-[4-(trifluoromethyl)phenyl]methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171273194 |
| Molecular Formula | C16H19Cl2F3N2S |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 1-[(R)-thiophen-2-yl-[4-(trifluoromethyl)phenyl]methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)c1ccc([C@H](c2cccs2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C16H17F3N2S.2ClH/c17-16(18,19)13-5-3-12(4-6-13)15(14-2-1-11-22-14)21-9-7-20-8-10-21;;/h1-6,11,15,20H,7-10H2;2*1H/t15-;;/m1../s1 |
| InChIKey | WJVNFKCINBIROR-QCUBGVIVSA-N |
| XLogP | 4.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |