C24H23F3N2 — CID 3939194
1-[(4-phenylphenyl)-[4-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 3939194) has the molecular formula C24H23F3N2 and a molecular weight of 396.46 g/mol. Its IUPAC name is 1-[(4-phenylphenyl)-[4-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-[(4-phenylphenyl)-[4-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 3939194 |
| Molecular Formula | C24H23F3N2 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 1-[(4-phenylphenyl)-[4-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | FC(F)(F)c1ccc(C(c2ccc(-c3ccccc3)cc2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C24H23F3N2/c25-24(26,27)22-12-10-21(11-13-22)23(29-16-14-28-15-17-29)20-8-6-19(7-9-20)18-4-2-1-3-5-18/h1-13,23,28H,14-17H2 |
| InChIKey | ASINPKXKILEQTR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |