C20H19F3N2S — CID 4214236
1-[1-benzothiophen-2-yl-[4-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 4214236) has the molecular formula C20H19F3N2S and a molecular weight of 376.45 g/mol. Its IUPAC name is 1-[1-benzothiophen-2-yl-[4-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-[1-benzothiophen-2-yl-[4-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 4214236 |
| Molecular Formula | C20H19F3N2S |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 1-[1-benzothiophen-2-yl-[4-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | FC(F)(F)c1ccc(C(c2cc3ccccc3s2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C20H19F3N2S/c21-20(22,23)16-7-5-14(6-8-16)19(25-11-9-24-10-12-25)18-13-15-3-1-2-4-17(15)26-18/h1-8,13,19,24H,9-12H2 |
| InChIKey | OJYRUCVPILNDCU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |