C21H24N2O2S — CID 3815031
1-[1-benzothiophen-2-yl-(2,4-dimethoxyphenyl)methyl]piperazine (PubChem CID 3815031) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is 1-[1-benzothiophen-2-yl-(2,4-dimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[1-benzothiophen-2-yl-(2,4-dimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 3815031 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 1-[1-benzothiophen-2-yl-(2,4-dimethoxyphenyl)methyl]piperazine |
| SMILES | COc1ccc(C(c2cc3ccccc3s2)N2CCNCC2)c(OC)c1 |
| InChI | InChI=1S/C21H24N2O2S/c1-24-16-7-8-17(18(14-16)25-2)21(23-11-9-22-10-12-23)20-13-15-5-3-4-6-19(15)26-20/h3-8,13-14,21-22H,9-12H2,1-2H3 |
| InChIKey | FFPAPRPTKRMVES-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |