C17H15ClO2S — CID 63433711
2-[chloro-(2,4-dimethoxyphenyl)methyl]-1-benzothiophene (PubChem CID 63433711) has the molecular formula C17H15ClO2S and a molecular weight of 318.83 g/mol. Its IUPAC name is 2-[chloro-(2,4-dimethoxyphenyl)methyl]-1-benzothiophene.
| Compound Name | 2-[chloro-(2,4-dimethoxyphenyl)methyl]-1-benzothiophene |
|---|---|
| PubChem CID | 63433711 |
| Molecular Formula | C17H15ClO2S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 2-[chloro-(2,4-dimethoxyphenyl)methyl]-1-benzothiophene |
| SMILES | COc1ccc(C(Cl)c2cc3ccccc3s2)c(OC)c1 |
| InChI | InChI=1S/C17H15ClO2S/c1-19-12-7-8-13(14(10-12)20-2)17(18)16-9-11-5-3-4-6-15(11)21-16/h3-10,17H,1-2H3 |
| InChIKey | YXVJZTFGWRDPHE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|