C15H8Cl2F2S — CID 107477430
2-[chloro-(2-chloro-4,5-difluorophenyl)methyl]-1-benzothiophene (PubChem CID 107477430) has the molecular formula C15H8Cl2F2S and a molecular weight of 329.20 g/mol. Its IUPAC name is 2-[chloro-(2-chloro-4,5-difluorophenyl)methyl]-1-benzothiophene.
| Compound Name | 2-[chloro-(2-chloro-4,5-difluorophenyl)methyl]-1-benzothiophene |
|---|---|
| PubChem CID | 107477430 |
| Molecular Formula | C15H8Cl2F2S |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | 2-[chloro-(2-chloro-4,5-difluorophenyl)methyl]-1-benzothiophene |
| SMILES | Fc1cc(Cl)c(C(Cl)c2cc3ccccc3s2)cc1F |
| InChI | InChI=1S/C15H8Cl2F2S/c16-10-7-12(19)11(18)6-9(10)15(17)14-5-8-3-1-2-4-13(8)20-14/h1-7,15H |
| InChIKey | JPYWMAQHPZOWIA-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|