C15H11Cl2NS — CID 61406696
1-benzothiophen-2-yl-(2,5-dichlorophenyl)methanamine (PubChem CID 61406696) has the molecular formula C15H11Cl2NS and a molecular weight of 308.23 g/mol. Its IUPAC name is 1-benzothiophen-2-yl-(2,5-dichlorophenyl)methanamine.
| Compound Name | 1-benzothiophen-2-yl-(2,5-dichlorophenyl)methanamine |
|---|---|
| PubChem CID | 61406696 |
| Molecular Formula | C15H11Cl2NS |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | 1-benzothiophen-2-yl-(2,5-dichlorophenyl)methanamine |
| SMILES | NC(c1cc2ccccc2s1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H11Cl2NS/c16-10-5-6-12(17)11(8-10)15(18)14-7-9-3-1-2-4-13(9)19-14/h1-8,15H,18H2 |
| InChIKey | NKUYSSIJUBMNTB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |