C16H13Cl2NS — CID 114909583
N-[1-(1-benzothiophen-2-yl)ethyl]-2,4-dichloroaniline (PubChem CID 114909583) has the molecular formula C16H13Cl2NS and a molecular weight of 322.26 g/mol. Its IUPAC name is N-[1-(1-benzothiophen-2-yl)ethyl]-2,4-dichloroaniline.
| Compound Name | N-[1-(1-benzothiophen-2-yl)ethyl]-2,4-dichloroaniline |
|---|---|
| PubChem CID | 114909583 |
| Molecular Formula | C16H13Cl2NS |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | N-[1-(1-benzothiophen-2-yl)ethyl]-2,4-dichloroaniline |
| SMILES | CC(Nc1ccc(Cl)cc1Cl)c1cc2ccccc2s1 |
| InChI | InChI=1S/C16H13Cl2NS/c1-10(19-14-7-6-12(17)9-13(14)18)16-8-11-4-2-3-5-15(11)20-16/h2-10,19H,1H3 |
| InChIKey | UIGBNHFESVBEJG-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |