C16H13Cl2NOS — CID 107678990
4-[1-(1-benzothiophen-2-yl)ethylamino]-2,6-dichlorophenol (PubChem CID 107678990) has the molecular formula C16H13Cl2NOS and a molecular weight of 338.26 g/mol. Its IUPAC name is 4-[1-(1-benzothiophen-2-yl)ethylamino]-2,6-dichlorophenol.
| Compound Name | 4-[1-(1-benzothiophen-2-yl)ethylamino]-2,6-dichlorophenol |
|---|---|
| PubChem CID | 107678990 |
| Molecular Formula | C16H13Cl2NOS |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 4-[1-(1-benzothiophen-2-yl)ethylamino]-2,6-dichlorophenol |
| SMILES | CC(Nc1cc(Cl)c(O)c(Cl)c1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C16H13Cl2NOS/c1-9(15-6-10-4-2-3-5-14(10)21-15)19-11-7-12(17)16(20)13(18)8-11/h2-9,19-20H,1H3 |
| InChIKey | SZTWAIXXJICECU-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|