C15H7Cl2F3S — CID 107477391
2-[chloro-(2-chloro-4,5-difluorophenyl)methyl]-6-fluoro-1-benzothiophene (PubChem CID 107477391) has the molecular formula C15H7Cl2F3S and a molecular weight of 347.19 g/mol. Its IUPAC name is 2-[chloro-(2-chloro-4,5-difluorophenyl)methyl]-6-fluoro-1-benzothiophene.
| Compound Name | 2-[chloro-(2-chloro-4,5-difluorophenyl)methyl]-6-fluoro-1-benzothiophene |
|---|---|
| PubChem CID | 107477391 |
| Molecular Formula | C15H7Cl2F3S |
| Molecular Weight | 347.19 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 2-[chloro-(2-chloro-4,5-difluorophenyl)methyl]-6-fluoro-1-benzothiophene |
| SMILES | Fc1ccc2cc(C(Cl)c3cc(F)c(F)cc3Cl)sc2c1 |
| InChI | InChI=1S/C15H7Cl2F3S/c16-10-6-12(20)11(19)5-9(10)15(17)14-3-7-1-2-8(18)4-13(7)21-14/h1-6,15H |
| InChIKey | NCFZDIRNTDDKNQ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.19 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|