C16H12ClF2NS — CID 105397335
1-(2-chloro-5-fluorophenyl)-1-(6-fluoro-1-benzothiophen-2-yl)-N-methylmethanamine (PubChem CID 105397335) has the molecular formula C16H12ClF2NS and a molecular weight of 323.80 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)-1-(6-fluoro-1-benzothiophen-2-yl)-N-methylmethanamine.
| Compound Name | 1-(2-chloro-5-fluorophenyl)-1-(6-fluoro-1-benzothiophen-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105397335 |
| Molecular Formula | C16H12ClF2NS |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)-1-(6-fluoro-1-benzothiophen-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1cc2ccc(F)cc2s1)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C16H12ClF2NS/c1-20-16(12-7-10(18)4-5-13(12)17)15-6-9-2-3-11(19)8-14(9)21-15/h2-8,16,20H,1H3 |
| InChIKey | QPOKICIGZFLGLX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |