C14H11ClFNS2 — CID 107361879
1-(3-chlorothiophen-2-yl)-1-(5-fluoro-1-benzothiophen-2-yl)-N-methylmethanamine (PubChem CID 107361879) has the molecular formula C14H11ClFNS2 and a molecular weight of 311.83 g/mol. Its IUPAC name is 1-(3-chlorothiophen-2-yl)-1-(5-fluoro-1-benzothiophen-2-yl)-N-methylmethanamine.
| Compound Name | 1-(3-chlorothiophen-2-yl)-1-(5-fluoro-1-benzothiophen-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 107361879 |
| Molecular Formula | C14H11ClFNS2 |
| Molecular Weight | 311.83 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | 1-(3-chlorothiophen-2-yl)-1-(5-fluoro-1-benzothiophen-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1cc2cc(F)ccc2s1)c1sccc1Cl |
| InChI | InChI=1S/C14H11ClFNS2/c1-17-13(14-10(15)4-5-18-14)12-7-8-6-9(16)2-3-11(8)19-12/h2-7,13,17H,1H3 |
| InChIKey | IQGRVWADFGUQHF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.83 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |