C15H14FNS2 — CID 105166566
1-(5-fluoro-1-benzothiophen-2-yl)-N-methyl-1-(3-methylthiophen-2-yl)methanamine (PubChem CID 105166566) has the molecular formula C15H14FNS2 and a molecular weight of 291.42 g/mol. Its IUPAC name is 1-(5-fluoro-1-benzothiophen-2-yl)-N-methyl-1-(3-methylthiophen-2-yl)methanamine.
| Compound Name | 1-(5-fluoro-1-benzothiophen-2-yl)-N-methyl-1-(3-methylthiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 105166566 |
| Molecular Formula | C15H14FNS2 |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 1-(5-fluoro-1-benzothiophen-2-yl)-N-methyl-1-(3-methylthiophen-2-yl)methanamine |
| SMILES | CNC(c1cc2cc(F)ccc2s1)c1sccc1C |
| InChI | InChI=1S/C15H14FNS2/c1-9-5-6-18-15(9)14(17-2)13-8-10-7-11(16)3-4-12(10)19-13/h3-8,14,17H,1-2H3 |
| InChIKey | FXJSPKNDCPFMMM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |