C17H15F2NS — CID 105087174
1-(5-fluoro-1-benzothiophen-2-yl)-2-(4-fluorophenyl)-N-methylethanamine (PubChem CID 105087174) has the molecular formula C17H15F2NS and a molecular weight of 303.38 g/mol. Its IUPAC name is 1-(5-fluoro-1-benzothiophen-2-yl)-2-(4-fluorophenyl)-N-methylethanamine.
| Compound Name | 1-(5-fluoro-1-benzothiophen-2-yl)-2-(4-fluorophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 105087174 |
| Molecular Formula | C17H15F2NS |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 1-(5-fluoro-1-benzothiophen-2-yl)-2-(4-fluorophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1ccc(F)cc1)c1cc2cc(F)ccc2s1 |
| InChI | InChI=1S/C17H15F2NS/c1-20-15(8-11-2-4-13(18)5-3-11)17-10-12-9-14(19)6-7-16(12)21-17/h2-7,9-10,15,20H,8H2,1H3 |
| InChIKey | DPEVWJYDUGBFBC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |